Di-(N-succinimidyl) adipate
| Cat. # | Quantity | Price | Lead time | Buy this product |
|---|---|---|---|---|
| PCL005_1 | 1 g | 75,00 € | in stock | |
| PCL005_5 | 5 g | 340,00 € | in stock | |
| PCL005_10 | 10 g | 540,00 € | in stock | |
| PCL005_50 | 50 g | 2.100,00 € | in stock |
- IUPAC Name: Bis(2,5-dioxopyrrolidin-1-yl) adipate
- Synonyms: DSA, Disuccinimidyl adipate, Disuccinimidyl hexanedioate
- CAS: 59156-70-6
- Smiles: O=C(ON1C(CCC1=O)=O)CCCCC(ON2C(CCC2=O)=O)=O
- Chemical formula: C14H16N2O8
- Molecular weight: 340.29
- Purity: 98%+
Di-(N-succinimidyl) adipate is an amine-reactive homobifunctional cross-linker. At neutral or slightly basic pH (7-9), it rapidly attacks solvent accessible lysine-NH2 groups and N-termini. While generally less often used than DSG, DSS and DSSeb, protein structure analysis based on chemical crosslinking with DSA can generate additional structural information.