4-Azidobutyric acid NHS ester
| Cat. # | Quantity | Price | Lead time | Buy this product |
|---|---|---|---|---|
| PCL015_0250 | 0.25 g | 150,00 € | in stock | |
| PCL015_0500 | 0.5 g | 240,00 € | in stock | |
| PCL015_1 | 1 g | 385,00 € | in stock | |
| PCL015_5 | 5 g | Enquire | in stock |
- IUPAC Name: 2,5-Dioxopyrrolidin-1-yl 4-azidobutanoate
- Synonyms: Azidobutyric NHS ester, NHS Azidobutyrate
- CAS: 943858-70-6
- Smiles: O=C(ON1C(CCC1=O)=O)CCCN=[N+]=[N-]
- Chemical formula: C8H10N4O4
- Molecular weight: 226.19
- Purity: 95%+
4-Azidobutyric acid NHS ester is an amine-reactive heterobifunctional cross-linker. At neutral or slightly basic pH (7-9), it rapidly attacks solvent accessible lysine-NH2 groups, N-termini and amines and installs the alkylazido group that serves as a bioorthogonal handle for copper-catalyzed alkyne-azide cycloaddition (CuAAC).